C19H23NO2 — CID 139666551
3,3-bis(phenylmethoxymethyl)azetidine (PubChem CID 139666551) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 3,3-bis(phenylmethoxymethyl)azetidine.
| Compound Name | 3,3-bis(phenylmethoxymethyl)azetidine |
|---|---|
| PubChem CID | 139666551 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3,3-bis(phenylmethoxymethyl)azetidine |
| SMILES | c1ccc(COCC2(COCc3ccccc3)CNC2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-3-7-17(8-4-1)11-21-15-19(13-20-14-19)16-22-12-18-9-5-2-6-10-18/h1-10,20H,11-16H2 |
| InChIKey | PCELGRIBEAZWLW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |