C24H32O4 — CID 134289630
[4,4-dimethoxy-1-(phenylmethoxymethyl)cyclohexyl]methoxymethylbenzene (PubChem CID 134289630) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [4,4-dimethoxy-1-(phenylmethoxymethyl)cyclohexyl]methoxymethylbenzene.
| Compound Name | [4,4-dimethoxy-1-(phenylmethoxymethyl)cyclohexyl]methoxymethylbenzene |
|---|---|
| PubChem CID | 134289630 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [4,4-dimethoxy-1-(phenylmethoxymethyl)cyclohexyl]methoxymethylbenzene |
| SMILES | COC1(OC)CCC(COCc2ccccc2)(COCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32O4/c1-25-24(26-2)15-13-23(14-16-24,19-27-17-21-9-5-3-6-10-21)20-28-18-22-11-7-4-8-12-22/h3-12H,13-20H2,1-2H3 |
| InChIKey | REKOVQZIPGFLJT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|