C22H29NO4 — CID 168984483
(2S)-1-[benzyl-[[3-(hydroxymethyl)oxetan-3-yl]methyl]amino]-3-phenylmethoxypropan-2-ol (PubChem CID 168984483) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2S)-1-[benzyl-[[3-(hydroxymethyl)oxetan-3-yl]methyl]amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2S)-1-[benzyl-[[3-(hydroxymethyl)oxetan-3-yl]methyl]amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 168984483 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2S)-1-[benzyl-[[3-(hydroxymethyl)oxetan-3-yl]methyl]amino]-3-phenylmethoxypropan-2-ol |
| SMILES | OCC1(CN(Cc2ccccc2)C[C@H](O)COCc2ccccc2)COC1 |
| InChI | InChI=1S/C22H29NO4/c24-16-22(17-27-18-22)15-23(11-19-7-3-1-4-8-19)12-21(25)14-26-13-20-9-5-2-6-10-20/h1-10,21,24-25H,11-18H2/t21-/m0/s1 |
| InChIKey | HOYGHDTYGBMCEI-NRFANRHFSA-N |
| XLogP | 2.08 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |