C25H29NO2 — CID 93164962
(2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol (PubChem CID 93164962) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 93164962 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S)-1-[benzyl-[(2-methylphenyl)methyl]amino]-3-phenylmethoxypropan-2-ol |
| SMILES | Cc1ccccc1CN(Cc1ccccc1)C[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C25H29NO2/c1-21-10-8-9-15-24(21)17-26(16-22-11-4-2-5-12-22)18-25(27)20-28-19-23-13-6-3-7-14-23/h2-15,25,27H,16-20H2,1H3/t25-/m0/s1 |
| InChIKey | FXWNNWBJKVRPLE-VWLOTQADSA-N |
| XLogP | 4.57 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |