C20H27NO3 — CID 78782772
1-[(3-methoxyphenyl)methoxy]-3-[methyl-[(2-methylphenyl)methyl]amino]propan-2-ol (PubChem CID 78782772) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methoxy]-3-[methyl-[(2-methylphenyl)methyl]amino]propan-2-ol.
| Compound Name | 1-[(3-methoxyphenyl)methoxy]-3-[methyl-[(2-methylphenyl)methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 78782772 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[(3-methoxyphenyl)methoxy]-3-[methyl-[(2-methylphenyl)methyl]amino]propan-2-ol |
| SMILES | COc1cccc(COCC(O)CN(C)Cc2ccccc2C)c1 |
| InChI | InChI=1S/C20H27NO3/c1-16-7-4-5-9-18(16)12-21(2)13-19(22)15-24-14-17-8-6-10-20(11-17)23-3/h4-11,19,22H,12-15H2,1-3H3 |
| InChIKey | UBECEDIAIDUVJC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |