C12H19NO3 — CID 78907088
3-[(3-methoxyphenyl)methyl-methylamino]propane-1,2-diol (PubChem CID 78907088) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-[(3-methoxyphenyl)methyl-methylamino]propane-1,2-diol.
| Compound Name | 3-[(3-methoxyphenyl)methyl-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 78907088 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-[(3-methoxyphenyl)methyl-methylamino]propane-1,2-diol |
| SMILES | COc1cccc(CN(C)CC(O)CO)c1 |
| InChI | InChI=1S/C12H19NO3/c1-13(8-11(15)9-14)7-10-4-3-5-12(6-10)16-2/h3-6,11,14-15H,7-9H2,1-2H3 |
| InChIKey | UWWHLPQLJKFSAF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |