C15H25NO2 — CID 103737738
6-[(3-methoxyphenyl)methyl-methylamino]hexan-1-ol (PubChem CID 103737738) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methyl-methylamino]hexan-1-ol.
| Compound Name | 6-[(3-methoxyphenyl)methyl-methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 103737738 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 6-[(3-methoxyphenyl)methyl-methylamino]hexan-1-ol |
| SMILES | COc1cccc(CN(C)CCCCCCO)c1 |
| InChI | InChI=1S/C15H25NO2/c1-16(10-5-3-4-6-11-17)13-14-8-7-9-15(12-14)18-2/h7-9,12,17H,3-6,10-11,13H2,1-2H3 |
| InChIKey | NCQDAVSVVKHHRV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|