C12H18N2O2S — CID 82850304
3-[[2,3-dihydroxypropyl(methyl)amino]methyl]benzenecarbothioamide (PubChem CID 82850304) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-[[2,3-dihydroxypropyl(methyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-[[2,3-dihydroxypropyl(methyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 82850304 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[[2,3-dihydroxypropyl(methyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(Cc1cccc(C(N)=S)c1)CC(O)CO |
| InChI | InChI=1S/C12H18N2O2S/c1-14(7-11(16)8-15)6-9-3-2-4-10(5-9)12(13)17/h2-5,11,15-16H,6-8H2,1H3,(H2,13,17) |
| InChIKey | CRRYMKQGSRGDHN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|