C18H22N2S — CID 62967219
3-[[methyl(3-phenylpropyl)amino]methyl]benzenecarbothioamide (PubChem CID 62967219) has the molecular formula C18H22N2S and a molecular weight of 298.46 g/mol. Its IUPAC name is 3-[[methyl(3-phenylpropyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-[[methyl(3-phenylpropyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 62967219 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 3-[[methyl(3-phenylpropyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(CCCc1ccccc1)Cc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C18H22N2S/c1-20(12-6-10-15-7-3-2-4-8-15)14-16-9-5-11-17(13-16)18(19)21/h2-5,7-9,11,13H,6,10,12,14H2,1H3,(H2,19,21) |
| InChIKey | BREWNVOVSHKUKY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|