C11H13F3N2S — CID 60891189
3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide (PubChem CID 60891189) has the molecular formula C11H13F3N2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 60891189 |
| Molecular Formula | C11H13F3N2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(Cc1cccc(C(N)=S)c1)CC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2S/c1-16(7-11(12,13)14)6-8-3-2-4-9(5-8)10(15)17/h2-5H,6-7H2,1H3,(H2,15,17) |
| InChIKey | AWKDYWVRBFTALF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|