C11H12F4N2S — CID 60892532
3-fluoro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide (PubChem CID 60892532) has the molecular formula C11H12F4N2S and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-fluoro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 60892532 |
| Molecular Formula | C11H12F4N2S |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-fluoro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(Cc1ccc(C(N)=S)cc1F)CC(F)(F)F |
| InChI | InChI=1S/C11H12F4N2S/c1-17(6-11(13,14)15)5-8-3-2-7(10(16)18)4-9(8)12/h2-4H,5-6H2,1H3,(H2,16,18) |
| InChIKey | FGSHDABUZSOUNQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|