C16H16Cl2N2S — CID 107306426
3-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]benzenecarbothioamide (PubChem CID 107306426) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 3-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]benzenecarbothioamide.
| Compound Name | 3-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107306426 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-[[(2,3-dichlorophenyl)methyl-methylamino]methyl]benzenecarbothioamide |
| SMILES | CN(Cc1cccc(C(N)=S)c1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2S/c1-20(10-13-6-3-7-14(17)15(13)18)9-11-4-2-5-12(8-11)16(19)21/h2-8H,9-10H2,1H3,(H2,19,21) |
| InChIKey | PHYIFQPLPUIJHC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|