C17H19FN2S — CID 114481716
4-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-methylbenzenecarbothioamide (PubChem CID 114481716) has the molecular formula C17H19FN2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-methylbenzenecarbothioamide.
| Compound Name | 4-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 114481716 |
| Molecular Formula | C17H19FN2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-[[(3-fluorophenyl)methyl-methylamino]methyl]-3-methylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1CN(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H19FN2S/c1-12-8-14(17(19)21)6-7-15(12)11-20(2)10-13-4-3-5-16(18)9-13/h3-9H,10-11H2,1-2H3,(H2,19,21) |
| InChIKey | DAGBFXBPPNLOPC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|