C17H20N2S2 — CID 79227420
3-[[methyl(2-phenylsulfanylethyl)amino]methyl]benzenecarbothioamide (PubChem CID 79227420) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 3-[[methyl(2-phenylsulfanylethyl)amino]methyl]benzenecarbothioamide.
| Compound Name | 3-[[methyl(2-phenylsulfanylethyl)amino]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 79227420 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-[[methyl(2-phenylsulfanylethyl)amino]methyl]benzenecarbothioamide |
| SMILES | CN(CCSc1ccccc1)Cc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C17H20N2S2/c1-19(10-11-21-16-8-3-2-4-9-16)13-14-6-5-7-15(12-14)17(18)20/h2-9,12H,10-11,13H2,1H3,(H2,18,20) |
| InChIKey | DHHUQUSCHIQZMQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|