C21H27NO5 — CID 41119766
ethyl 4-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methyl-methylamino]propoxy]benzoate (PubChem CID 41119766) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methyl-methylamino]propoxy]benzoate.
| Compound Name | ethyl 4-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methyl-methylamino]propoxy]benzoate |
|---|---|
| PubChem CID | 41119766 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | ethyl 4-[(2S)-2-hydroxy-3-[(3-methoxyphenyl)methyl-methylamino]propoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OC[C@@H](O)CN(C)Cc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H27NO5/c1-4-26-21(24)17-8-10-19(11-9-17)27-15-18(23)14-22(2)13-16-6-5-7-20(12-16)25-3/h5-12,18,23H,4,13-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | MJLSFIVNCXTTKG-SFHVURJKSA-N |
| XLogP | 2.74 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |