C21H24N2O4 — CID 86931329
ethyl 3-[3-[(3-cyanophenyl)methyl-methylamino]-2-hydroxypropoxy]benzoate (PubChem CID 86931329) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl 3-[3-[(3-cyanophenyl)methyl-methylamino]-2-hydroxypropoxy]benzoate.
| Compound Name | ethyl 3-[3-[(3-cyanophenyl)methyl-methylamino]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 86931329 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 3-[3-[(3-cyanophenyl)methyl-methylamino]-2-hydroxypropoxy]benzoate |
| SMILES | CCOC(=O)c1cccc(OCC(O)CN(C)Cc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-26-21(25)18-8-5-9-20(11-18)27-15-19(24)14-23(2)13-17-7-4-6-16(10-17)12-22/h4-11,19,24H,3,13-15H2,1-2H3 |
| InChIKey | HKJJUGYIFNGFOI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |