C68H66N4O4 — CID 59372141
4-N,4-N-bis[4-(N-[4-[(3-ethyloxetan-3-yl)methoxymethyl]phenyl]anilino)phenyl]-1-N,1-N-diphenylbenzene-1,4-diamine (PubChem CID 59372141) has the molecular formula C68H66N4O4 and a molecular weight of 1003.30 g/mol. Its IUPAC name is 4-N,4-N-bis[4-(N-[4-[(3-ethyloxetan-3-yl)methoxymethyl]phenyl]anilino)phenyl]-1-N,1-N-diphenylbenzene-1,4-diamine.
| Compound Name | 4-N,4-N-bis[4-(N-[4-[(3-ethyloxetan-3-yl)methoxymethyl]phenyl]anilino)phenyl]-1-N,1-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 59372141 |
| Molecular Formula | C68H66N4O4 |
| Molecular Weight | 1003.30 g/mol |
| Exact Mass | 1002.51 |
| IUPAC Name | 4-N,4-N-bis[4-(N-[4-[(3-ethyloxetan-3-yl)methoxymethyl]phenyl]anilino)phenyl]-1-N,1-N-diphenylbenzene-1,4-diamine |
| SMILES | CCC1(COCc2ccc(N(c3ccccc3)c3ccc(N(c4ccc(N(c5ccccc5)c5ccccc5)cc4)c4ccc(N(c5ccccc5)c5ccc(COCC6(CC)COC6)cc5)cc4)cc3)cc2)COC1 |
| InChI | InChI=1S/C68H66N4O4/c1-3-67(49-75-50-67)47-73-45-53-25-29-59(30-26-53)70(57-21-13-7-14-22-57)62-35-41-65(42-36-62)72(64-39-33-61(34-40-64)69(55-17-9-5-10-18-55)56-19-11-6-12-20-56)66-43-37-63(38-44-66)71(58-23-15-8-16-24-58)60-31-27-54(28-32-60)46-74-48-68(4-2)51-76-52-68/h5-44H,3-4,45-52H2,1-2H3 |
| InChIKey | NNPPUOARPXJHFY-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.30 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |