C16H24O2 — CID 174397153
3-ethyl-3-[(2-propylphenyl)methoxymethyl]oxetane (PubChem CID 174397153) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-ethyl-3-[(2-propylphenyl)methoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[(2-propylphenyl)methoxymethyl]oxetane |
|---|---|
| PubChem CID | 174397153 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-ethyl-3-[(2-propylphenyl)methoxymethyl]oxetane |
| SMILES | CCCc1ccccc1COCC1(CC)COC1 |
| InChI | InChI=1S/C16H24O2/c1-3-7-14-8-5-6-9-15(14)10-17-11-16(4-2)12-18-13-16/h5-6,8-9H,3-4,7,10-13H2,1-2H3 |
| InChIKey | ZSFHNFGCWNLGEJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |