C13H14O4S — CID 86212389
(5-methyl-2-sulfanylidene-1,3-dioxan-5-yl)methyl benzoate (PubChem CID 86212389) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is (5-methyl-2-sulfanylidene-1,3-dioxan-5-yl)methyl benzoate.
| Compound Name | (5-methyl-2-sulfanylidene-1,3-dioxan-5-yl)methyl benzoate |
|---|---|
| PubChem CID | 86212389 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (5-methyl-2-sulfanylidene-1,3-dioxan-5-yl)methyl benzoate |
| SMILES | CC1(COC(=O)c2ccccc2)COC(=S)OC1 |
| InChI | InChI=1S/C13H14O4S/c1-13(8-16-12(18)17-9-13)7-15-11(14)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | JPFVMCNTAGAEGP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|