C13H16O5 — CID 170219507
[(2R,3S,4S)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl benzoate (PubChem CID 170219507) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(2R,3S,4S)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 170219507 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [(2R,3S,4S)-3,4-dihydroxy-2-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@]1(COC(=O)c2ccccc2)OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H16O5/c1-13(11(15)10(14)7-18-13)8-17-12(16)9-5-3-2-4-6-9/h2-6,10-11,14-15H,7-8H2,1H3/t10-,11-,13+/m0/s1 |
| InChIKey | TVIWTVOQPKZJNM-GMXVVIOVSA-N |
| XLogP | 0.35 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |