C13H16O5 — CID 59792406
[2-(hydroxymethyl)-1,3-dioxan-2-yl]methyl benzoate (PubChem CID 59792406) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is [2-(hydroxymethyl)-1,3-dioxan-2-yl]methyl benzoate.
| Compound Name | [2-(hydroxymethyl)-1,3-dioxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 59792406 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [2-(hydroxymethyl)-1,3-dioxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1(CO)OCCCO1)c1ccccc1 |
| InChI | InChI=1S/C13H16O5/c14-9-13(17-7-4-8-18-13)10-16-12(15)11-5-2-1-3-6-11/h1-3,5-6,14H,4,7-10H2 |
| InChIKey | UCEVJIZNZYIXTM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |