C26H20O5 — CID 118899810
[8-(benzoyloxymethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methyl benzoate (PubChem CID 118899810) has the molecular formula C26H20O5 and a molecular weight of 412.44 g/mol. Its IUPAC name is [8-(benzoyloxymethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methyl benzoate.
| Compound Name | [8-(benzoyloxymethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 118899810 |
| Molecular Formula | C26H20O5 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [8-(benzoyloxymethyl)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methyl benzoate |
| SMILES | O=C(OCC12C=CC(COC(=O)c3ccccc3)(O1)c1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C26H20O5/c27-23(19-9-3-1-4-10-19)29-17-25-15-16-26(31-25,22-14-8-7-13-21(22)25)18-30-24(28)20-11-5-2-6-12-20/h1-16H,17-18H2 |
| InChIKey | UQZYTRARZAZUKZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|