C13H15FO4 — CID 123554530
(3-fluoro-4-hydroxy-4-methyloxolan-2-yl)methyl benzoate (PubChem CID 123554530) has the molecular formula C13H15FO4 and a molecular weight of 254.26 g/mol. Its IUPAC name is (3-fluoro-4-hydroxy-4-methyloxolan-2-yl)methyl benzoate.
| Compound Name | (3-fluoro-4-hydroxy-4-methyloxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 123554530 |
| Molecular Formula | C13H15FO4 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (3-fluoro-4-hydroxy-4-methyloxolan-2-yl)methyl benzoate |
| SMILES | CC1(O)COC(COC(=O)c2ccccc2)C1F |
| InChI | InChI=1S/C13H15FO4/c1-13(16)8-18-10(11(13)14)7-17-12(15)9-5-3-2-4-6-9/h2-6,10-11,16H,7-8H2,1H3 |
| InChIKey | HMMFRMIJRMBCIC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |