C14H17FO4 — CID 123810467
(3-fluoro-5-methoxy-4-methyloxolan-2-yl)methyl benzoate (PubChem CID 123810467) has the molecular formula C14H17FO4 and a molecular weight of 268.28 g/mol. Its IUPAC name is (3-fluoro-5-methoxy-4-methyloxolan-2-yl)methyl benzoate.
| Compound Name | (3-fluoro-5-methoxy-4-methyloxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 123810467 |
| Molecular Formula | C14H17FO4 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3-fluoro-5-methoxy-4-methyloxolan-2-yl)methyl benzoate |
| SMILES | COC1OC(COC(=O)c2ccccc2)C(F)C1C |
| InChI | InChI=1S/C14H17FO4/c1-9-12(15)11(19-14(9)17-2)8-18-13(16)10-6-4-3-5-7-10/h3-7,9,11-12,14H,8H2,1-2H3 |
| InChIKey | ULMZKQVOTZPOCE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |