C15H18O5 — CID 58498505
(5-methyl-2-oxo-1,3-dioxan-5-yl)methyl 3-phenylpropanoate (PubChem CID 58498505) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (5-methyl-2-oxo-1,3-dioxan-5-yl)methyl 3-phenylpropanoate.
| Compound Name | (5-methyl-2-oxo-1,3-dioxan-5-yl)methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 58498505 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (5-methyl-2-oxo-1,3-dioxan-5-yl)methyl 3-phenylpropanoate |
| SMILES | CC1(COC(=O)CCc2ccccc2)COC(=O)OC1 |
| InChI | InChI=1S/C15H18O5/c1-15(10-19-14(17)20-11-15)9-18-13(16)8-7-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3 |
| InChIKey | PUYGFNSNRBHBQN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |