C14H16Cl2O2 — CID 101046799
(2,2-dichloro-1-methylcyclopropyl)methyl 3-phenylpropanoate (PubChem CID 101046799) has the molecular formula C14H16Cl2O2 and a molecular weight of 287.19 g/mol. Its IUPAC name is (2,2-dichloro-1-methylcyclopropyl)methyl 3-phenylpropanoate.
| Compound Name | (2,2-dichloro-1-methylcyclopropyl)methyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 101046799 |
| Molecular Formula | C14H16Cl2O2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | (2,2-dichloro-1-methylcyclopropyl)methyl 3-phenylpropanoate |
| SMILES | CC1(COC(=O)CCc2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2O2/c1-13(9-14(13,15)16)10-18-12(17)8-7-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3 |
| InChIKey | GZFVIMULKIFLJW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|