C17H15NO4 — CID 134948763
[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-4-yl]methyl benzoate (PubChem CID 134948763) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is [(4S)-2-oxo-4-phenyl-1,3-oxazolidin-4-yl]methyl benzoate.
| Compound Name | [(4S)-2-oxo-4-phenyl-1,3-oxazolidin-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 134948763 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(4S)-2-oxo-4-phenyl-1,3-oxazolidin-4-yl]methyl benzoate |
| SMILES | O=C1N[C@](COC(=O)c2ccccc2)(c2ccccc2)CO1 |
| InChI | InChI=1S/C17H15NO4/c19-15(13-7-3-1-4-8-13)21-11-17(12-22-16(20)18-17)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,18,20)/t17-/m0/s1 |
| InChIKey | OCDPXLVQBLHJEO-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |