About (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate
(3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate (PubChem CID 165176051) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate |
| PubChem CID | 165176051 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate |
| SMILES | CC1(COC(=O)c2ccc[nH]2)COC1 |
| InChI | InChI=1S/C10H13NO3/c1-10(5-13-6-10)7-14-9(12)8-3-2-4-11-8/h2-4,11H,5-7H2,1H3 |
| InChIKey | WBYQOGMWXTUVNF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate?
The IUPAC name of (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate (CID 165176051) is (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate?
The canonical SMILES for (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate is CC1(COC(=O)c2ccc[nH]2)COC1.
What is the InChIKey of (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate?
The InChIKey is WBYQOGMWXTUVNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-10(5-13-6-10)7-14-9(12)8-3-2-4-11-8/h2-4,11H,5-7H2,1H3.
What are the key properties of (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate?
(3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxetan-3-yl)methyl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 165176051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).