C21H36O2 — CID 2724557
3-hydroxy-1,3-bis(1,2,2,3-tetramethylcyclopentyl)prop-2-en-1-one (PubChem CID 2724557) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 3-hydroxy-1,3-bis(1,2,2,3-tetramethylcyclopentyl)prop-2-en-1-one.
| Compound Name | 3-hydroxy-1,3-bis(1,2,2,3-tetramethylcyclopentyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2724557 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 3-hydroxy-1,3-bis(1,2,2,3-tetramethylcyclopentyl)prop-2-en-1-one |
| SMILES | CC1CCC(C)(C(=O)C=C(O)C2(C)CCC(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C21H36O2/c1-14-9-11-20(7,18(14,3)4)16(22)13-17(23)21(8)12-10-15(2)19(21,5)6/h13-15,22H,9-12H2,1-8H3 |
| InChIKey | ZPWDPOBPQQLWEE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|