C21H38ClNO2 — CID 2750729
methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium chloride (PubChem CID 2750729) has the molecular formula C21H38ClNO2 and a molecular weight of 371.99 g/mol. Its IUPAC name is methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium chloride.
| Compound Name | methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium chloride |
|---|---|
| PubChem CID | 2750729 |
| Molecular Formula | C21H38ClNO2 |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium chloride |
| SMILES | CC1CCC(C)(C(=O)[NH+](C)C(=O)C2(C)CCC(C)C2(C)C)C1(C)C.[Cl-] |
| InChI | InChI=1S/C21H37NO2.ClH/c1-14-10-12-20(7,18(14,3)4)16(23)22(9)17(24)21(8)13-11-15(2)19(21,5)6;/h14-15H,10-13H2,1-9H3;1H |
| InChIKey | LLKYCOLIIYKFDZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|