C6H8O — CID 23262330
(2S,3S)-2-ethynyl-2,3-dimethyloxirane (PubChem CID 23262330) has the molecular formula C6H8O and a molecular weight of 96.13 g/mol. Its IUPAC name is (2S,3S)-2-ethynyl-2,3-dimethyloxirane.
| Compound Name | (2S,3S)-2-ethynyl-2,3-dimethyloxirane |
|---|---|
| PubChem CID | 23262330 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | (2S,3S)-2-ethynyl-2,3-dimethyloxirane |
| SMILES | C#C[C@]1(C)O[C@H]1C |
| InChI | InChI=1S/C6H8O/c1-4-6(3)5(2)7-6/h1,5H,2-3H3/t5-,6-/m0/s1 |
| InChIKey | CXKCCKWCBIQXTA-WDSKDSINSA-N |
| XLogP | 0.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|