C8H12O2 — CID 102245349
(4R,5S)-4-ethynyl-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 102245349) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (4R,5S)-4-ethynyl-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-ethynyl-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 102245349 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (4R,5S)-4-ethynyl-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C#C[C@H]1OC(C)(C)O[C@H]1C |
| InChI | InChI=1S/C8H12O2/c1-5-7-6(2)9-8(3,4)10-7/h1,6-7H,2-4H3/t6-,7+/m0/s1 |
| InChIKey | WMYINBBZTHWKOC-NKWVEPMBSA-N |
| XLogP | 1.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|