C17H30O2 — CID 10967466
(4R,5R)-4-decyl-5-ethynyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 10967466) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (4R,5R)-4-decyl-5-ethynyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5R)-4-decyl-5-ethynyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10967466 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (4R,5R)-4-decyl-5-ethynyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | C#C[C@H]1OC(C)(C)O[C@@H]1CCCCCCCCCC |
| InChI | InChI=1S/C17H30O2/c1-5-7-8-9-10-11-12-13-14-16-15(6-2)18-17(3,4)19-16/h2,15-16H,5,7-14H2,1,3-4H3/t15-,16-/m1/s1 |
| InChIKey | MKOHFEDNWWZNMN-HZPDHXFCSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|