C22H42O2S2 — CID 11761237
(4R,5S)-4-[5-(1,3-dithian-2-yl)pentyl]-2,2-dimethyl-5-octyl-1,3-dioxolane (PubChem CID 11761237) has the molecular formula C22H42O2S2 and a molecular weight of 402.71 g/mol. Its IUPAC name is (4R,5S)-4-[5-(1,3-dithian-2-yl)pentyl]-2,2-dimethyl-5-octyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[5-(1,3-dithian-2-yl)pentyl]-2,2-dimethyl-5-octyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11761237 |
| Molecular Formula | C22H42O2S2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4R,5S)-4-[5-(1,3-dithian-2-yl)pentyl]-2,2-dimethyl-5-octyl-1,3-dioxolane |
| SMILES | CCCCCCCC[C@@H]1OC(C)(C)O[C@@H]1CCCCCC1SCCCS1 |
| InChI | InChI=1S/C22H42O2S2/c1-4-5-6-7-8-10-14-19-20(24-22(2,3)23-19)15-11-9-12-16-21-25-17-13-18-26-21/h19-21H,4-18H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | RVXAWPCPBUCYFS-VQTJNVASSA-N |
| XLogP | 7.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|