C19H32O2 — CID 11119906
(4S,5S)-4-(2-cyclohexa-1,5-dien-1-ylethyl)-5-hexyl-2,2-dimethyl-1,3-dioxolane (PubChem CID 11119906) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (4S,5S)-4-(2-cyclohexa-1,5-dien-1-ylethyl)-5-hexyl-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-(2-cyclohexa-1,5-dien-1-ylethyl)-5-hexyl-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11119906 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (4S,5S)-4-(2-cyclohexa-1,5-dien-1-ylethyl)-5-hexyl-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCCC[C@@H]1OC(C)(C)O[C@H]1CCC1=CCCC=C1 |
| InChI | InChI=1S/C19H32O2/c1-4-5-6-10-13-17-18(21-19(2,3)20-17)15-14-16-11-8-7-9-12-16/h8,11-12,17-18H,4-7,9-10,13-15H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | KRTMDRAPMQWWKY-ROUUACIJSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|