C36H50O2P+ — CID 10604506
3-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl-triphenylphosphanium (PubChem CID 10604506) has the molecular formula C36H50O2P+ and a molecular weight of 545.77 g/mol. Its IUPAC name is 3-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl-triphenylphosphanium.
| Compound Name | 3-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl-triphenylphosphanium |
|---|---|
| PubChem CID | 10604506 |
| Molecular Formula | C36H50O2P+ |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | 3-[(4R,5S)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl-triphenylphosphanium |
| SMILES | CCCCCCCCCC[C@@H]1OC(C)(C)O[C@@H]1CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H50O2P/c1-4-5-6-7-8-9-10-20-28-34-35(38-36(2,3)37-34)29-21-30-39(31-22-14-11-15-23-31,32-24-16-12-17-25-32)33-26-18-13-19-27-33/h11-19,22-27,34-35H,4-10,20-21,28-30H2,1-3H3/q+1/t34-,35+/m0/s1 |
| InChIKey | RYHDSNNBRRGLPC-OIDHKYIRSA-N |
| XLogP | 8.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|