C16H30S4 — CID 3335424
2-[8-(1,3-dithian-2-yl)octyl]-1,3-dithiane (PubChem CID 3335424) has the molecular formula C16H30S4 and a molecular weight of 350.68 g/mol. Its IUPAC name is 2-[8-(1,3-dithian-2-yl)octyl]-1,3-dithiane.
| Compound Name | 2-[8-(1,3-dithian-2-yl)octyl]-1,3-dithiane |
|---|---|
| PubChem CID | 3335424 |
| Molecular Formula | C16H30S4 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[8-(1,3-dithian-2-yl)octyl]-1,3-dithiane |
| SMILES | C(CCCCC1SCCCS1)CCCC1SCCCS1 |
| InChI | InChI=1S/C16H30S4/c1(3-5-9-15-17-11-7-12-18-15)2-4-6-10-16-19-13-8-14-20-16/h15-16H,1-14H2 |
| InChIKey | QSVFVFXGAXUSNY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|