C10H20O2 — CID 59124579
(5S,6S)-2,2,3,3,5,6-hexamethyl-1,4-dioxane (PubChem CID 59124579) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (5S,6S)-2,2,3,3,5,6-hexamethyl-1,4-dioxane.
| Compound Name | (5S,6S)-2,2,3,3,5,6-hexamethyl-1,4-dioxane |
|---|---|
| PubChem CID | 59124579 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (5S,6S)-2,2,3,3,5,6-hexamethyl-1,4-dioxane |
| SMILES | C[C@@H]1OC(C)(C)C(C)(C)O[C@H]1C |
| InChI | InChI=1S/C10H20O2/c1-7-8(2)12-10(5,6)9(3,4)11-7/h7-8H,1-6H3/t7-,8-/m0/s1 |
| InChIKey | ZREZZSPXPRBWDW-YUMQZZPRSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |