C7H14O4 — CID 130875255
(2R,3R)-2,5,6-trimethyl-1,4-dioxane-2,3-diol (PubChem CID 130875255) has the molecular formula C7H14O4 and a molecular weight of 162.18 g/mol. Its IUPAC name is (2R,3R)-2,5,6-trimethyl-1,4-dioxane-2,3-diol.
| Compound Name | (2R,3R)-2,5,6-trimethyl-1,4-dioxane-2,3-diol |
|---|---|
| PubChem CID | 130875255 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2R,3R)-2,5,6-trimethyl-1,4-dioxane-2,3-diol |
| SMILES | CC1O[C@@H](O)[C@](C)(O)OC1C |
| InChI | InChI=1S/C7H14O4/c1-4-5(2)11-7(3,9)6(8)10-4/h4-6,8-9H,1-3H3/t4?,5?,6-,7-/m1/s1 |
| InChIKey | RSUQXBHHMIWUQN-TVVDDFTJSA-N |
| XLogP | -0.16 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |