C6H12O3 — CID 163961181
(4R,5S)-2,4,5-trimethyl-1,3-dioxolan-2-ol (PubChem CID 163961181) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (4R,5S)-2,4,5-trimethyl-1,3-dioxolan-2-ol.
| Compound Name | (4R,5S)-2,4,5-trimethyl-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 163961181 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (4R,5S)-2,4,5-trimethyl-1,3-dioxolan-2-ol |
| SMILES | C[C@@H]1OC(C)(O)O[C@@H]1C |
| InChI | InChI=1S/C6H12O3/c1-4-5(2)9-6(3,7)8-4/h4-5,7H,1-3H3/t4-,5+,6? |
| InChIKey | SHPFUYRNRVBVEO-XEAPYIEGSA-N |
| XLogP | 0.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |