C9H17NO5 — CID 172733347
N-[(2R,3R,4S,5S)-4,5,6-trihydroxy-2,4,5-trimethyloxan-3-yl]formamide (PubChem CID 172733347) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[(2R,3R,4S,5S)-4,5,6-trihydroxy-2,4,5-trimethyloxan-3-yl]formamide.
| Compound Name | N-[(2R,3R,4S,5S)-4,5,6-trihydroxy-2,4,5-trimethyloxan-3-yl]formamide |
|---|---|
| PubChem CID | 172733347 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(2R,3R,4S,5S)-4,5,6-trihydroxy-2,4,5-trimethyloxan-3-yl]formamide |
| SMILES | C[C@H]1OC(O)[C@@](C)(O)[C@@](C)(O)[C@@H]1NC=O |
| InChI | InChI=1S/C9H17NO5/c1-5-6(10-4-11)8(2,13)9(3,14)7(12)15-5/h4-7,12-14H,1-3H3,(H,10,11)/t5-,6-,7?,8+,9-/m1/s1 |
| InChIKey | ICBUHVAYXYIUFN-QVEDDBAWSA-N |
| XLogP | -1.66 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|