C8H14O4 — CID 54571248
(1R,4S,5R)-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol (PubChem CID 54571248) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (1R,4S,5R)-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol.
| Compound Name | (1R,4S,5R)-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol |
|---|---|
| PubChem CID | 54571248 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (1R,4S,5R)-4,6,6-trimethyl-3-oxabicyclo[3.1.0]hexane-1,2,5-triol |
| SMILES | C[C@@H]1OC(O)[C@@]2(O)C(C)(C)[C@@]12O |
| InChI | InChI=1S/C8H14O4/c1-4-7(10)6(2,3)8(7,11)5(9)12-4/h4-5,9-11H,1-3H3/t4-,5?,7-,8+/m0/s1 |
| InChIKey | ZXKCIRQZTMPXKT-JCOGBBHBSA-N |
| XLogP | -0.77 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |