C10H18INO4 — CID 11089173
N-[(2S,3S,4R,5R,6R)-4-hydroxy-5-iodo-6-methoxy-2,4-dimethyloxan-3-yl]acetamide (PubChem CID 11089173) has the molecular formula C10H18INO4 and a molecular weight of 343.16 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R,6R)-4-hydroxy-5-iodo-6-methoxy-2,4-dimethyloxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5R,6R)-4-hydroxy-5-iodo-6-methoxy-2,4-dimethyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11089173 |
| Molecular Formula | C10H18INO4 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[(2S,3S,4R,5R,6R)-4-hydroxy-5-iodo-6-methoxy-2,4-dimethyloxan-3-yl]acetamide |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](NC(C)=O)[C@@](C)(O)[C@H]1I |
| InChI | InChI=1S/C10H18INO4/c1-5-8(12-6(2)13)10(3,14)7(11)9(15-4)16-5/h5,7-9,14H,1-4H3,(H,12,13)/t5-,7-,8-,9+,10-/m0/s1 |
| InChIKey | TWBDCBWRYSZYBX-LWFNUECDSA-N |
| XLogP | 0.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|