C12H18F3NO5 — CID 11130786
N-[(3aR,4R,6S,7R,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide (PubChem CID 11130786) has the molecular formula C12H18F3NO5 and a molecular weight of 313.27 g/mol. Its IUPAC name is N-[(3aR,4R,6S,7R,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aR,4R,6S,7R,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11130786 |
| Molecular Formula | C12H18F3NO5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[(3aR,4R,6S,7R,7aR)-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-2,2,2-trifluoroacetamide |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](NC(=O)C(F)(F)F)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18F3NO5/c1-5-6(16-10(17)12(13,14)15)7-8(9(18-4)19-5)21-11(2,3)20-7/h5-9H,1-4H3,(H,16,17)/t5-,6+,7+,8+,9+/m0/s1 |
| InChIKey | GXBLLXHEKURTPR-XDQCBXAXSA-N |
| XLogP | 0.94 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |