C11H14F3NO5 — CID 88776542
N-[(3aR,5S,6R,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide (PubChem CID 88776542) has the molecular formula C11H14F3NO5 and a molecular weight of 297.23 g/mol. Its IUPAC name is N-[(3aR,5S,6R,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aR,5S,6R,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 88776542 |
| Molecular Formula | C11H14F3NO5 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(3aR,5S,6R,6aR)-2,2-dimethyl-5-[(2S)-oxiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CO3)[C@@H](NC(=O)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C11H14F3NO5/c1-10(2)19-7-5(15-9(16)11(12,13)14)6(4-3-17-4)18-8(7)20-10/h4-8H,3H2,1-2H3,(H,15,16)/t4-,5+,6+,7+,8+/m0/s1 |
| InChIKey | CWWBKXAYSVEAKI-SLBCVNJHSA-N |
| XLogP | 0.31 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|