C16H25NO6 — CID 22858880
N-[(5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-methylprop-2-enamide (PubChem CID 22858880) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[(5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-methylprop-2-enamide.
| Compound Name | N-[(5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22858880 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[(5S,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@H]1[C@@H]([C@H]2COC(C)(C)O2)OC2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H25NO6/c1-8(2)13(18)17-10-11(9-7-19-15(3,4)21-9)20-14-12(10)22-16(5,6)23-14/h9-12,14H,1,7H2,2-6H3,(H,17,18)/t9-,10+,11-,12-,14?/m1/s1 |
| InChIKey | ISHDQDHNBQXKOY-HMMZJVQESA-N |
| XLogP | 1.08 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|