C19H25N3O8 — CID 24876925
1-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-nitrophenyl)urea (PubChem CID 24876925) has the molecular formula C19H25N3O8 and a molecular weight of 423.42 g/mol. Its IUPAC name is 1-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 24876925 |
| Molecular Formula | C19H25N3O8 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-[(3aR,5S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-nitrophenyl)urea |
| SMILES | CC1(C)OCC([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3C2NC(=O)Nc2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C19H25N3O8/c1-18(2)26-9-12(28-18)14-13(15-16(27-14)30-19(3,4)29-15)21-17(23)20-10-5-7-11(8-6-10)22(24)25/h5-8,12-16H,9H2,1-4H3,(H2,20,21,23)/t12?,13?,14-,15-,16-/m1/s1 |
| InChIKey | GIVMTQIEHKLYHL-KDQUWOQTSA-N |
| XLogP | 2.11 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|