C19H25ClN2O5S — CID 87761209
1-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-chlorophenyl)thiourea (PubChem CID 87761209) has the molecular formula C19H25ClN2O5S and a molecular weight of 428.94 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 87761209 |
| Molecular Formula | C19H25ClN2O5S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-chlorophenyl)thiourea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@@H](NC(=S)Nc3cccc(Cl)c3)[C@H]2O1 |
| InChI | InChI=1S/C19H25ClN2O5S/c1-18(2)23-9-12(25-18)14-13(15-16(24-14)27-19(3,4)26-15)22-17(28)21-11-7-5-6-10(20)8-11/h5-8,12-16H,9H2,1-4H3,(H2,21,22,28)/t12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | UXIZCRQOPLGRKP-OXGONZEZSA-N |
| XLogP | 3.02 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|