C16H21N3O7S — CID 25065016
1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-nitrophenyl)thiourea (PubChem CID 25065016) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-nitrophenyl)thiourea.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 25065016 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(3-nitrophenyl)thiourea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CO)[C@H](NC(=S)Nc3cccc([N+](=O)[O-])c3)[C@H]2O1 |
| InChI | InChI=1S/C16H21N3O7S/c1-16(2)25-13-11(12(10(21)7-20)24-14(13)26-16)18-15(27)17-8-4-3-5-9(6-8)19(22)23/h3-6,10-14,20-21H,7H2,1-2H3,(H2,17,18,27)/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | WDJAWESVEAONTP-XVIXHAIJSA-N |
| XLogP | 0.48 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|