C17H21N3O5S — CID 25067081
1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea (PubChem CID 25067081) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea.
| Compound Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea |
|---|---|
| PubChem CID | 25067081 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[(3aR,5S,6S,6aR)-5-[(1R)-1,2-dihydroxyethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-3-(4-cyanophenyl)thiourea |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](O)CO)[C@H](NC(=S)Nc3ccc(C#N)cc3)[C@H]2O1 |
| InChI | InChI=1S/C17H21N3O5S/c1-17(2)24-14-12(13(11(22)8-21)23-15(14)25-17)20-16(26)19-10-5-3-9(7-18)4-6-10/h3-6,11-15,21-22H,8H2,1-2H3,(H2,19,20,26)/t11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | IVCWSVLFABKLNQ-XLWJZTARSA-N |
| XLogP | 0.44 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|